1. 22 Jan, 2011 2 commits
  2. 21 Jan, 2011 9 commits
    • ap@apple.com's avatar
      Reviewed by Dan Bernstein. · 9d1b66c3
      ap@apple.com authored
              Objective-C files should use #import, not #include
              * UIProcess/API/C/WebKit2.h: This is an interesting one, because it's cross-platform, and
              there is more than one WKView.h.
              * Platform/mac/ModuleMac.mm:
              * Platform/mac/RunLoopMac.mm:
              * PluginProcess/mac/PluginControllerProxyMac.mm:
              * PluginProcess/mac/PluginProcessMac.mm:
              * PluginProcess/mac/PluginProcessMainMac.mm:
              * Shared/API/c/mac/WKCertificateInfoMac.mm:
              * Shared/API/c/mac/WKURLRequestNS.mm:
              * Shared/API/c/mac/WKURLResponseNS.mm:
              * Shared/Plugins/Netscape/mac/NetscapePluginModuleMac.mm:
              * Shared/mac/PlatformCertificateInfo.mm:
              * Shared/mac/SandboxExtensionMac.mm:
              * Shared/mac/WebCoreArgumentCodersMac.mm:
              * Shared/mac/WebMemorySampler.mac.mm:
              * Shared/mac/WebURLRequestMac.mm:
              * Shared/mac/WebURLResponseMac.mm:
              * UIProcess/API/mac/FindIndicatorWindow.mm:
              * UIProcess/API/mac/WKTextInputWindowController.mm:
              * UIProcess/Launcher/mac/ProcessLauncherMac.mm:
              * UIProcess/Launcher/mac/ThreadLauncherMac.mm:
              * UIProcess/Plugins/mac/PluginInfoStoreMac.mm:
              * UIProcess/Plugins/mac/PluginProcessProxyMac.mm:
              * UIProcess/mac/BackingStoreMac.mm:
              * UIProcess/mac/ChunkedUpdateDrawingAreaProxyMac.mm:
              * UIProcess/mac/LayerBackedDrawingAreaProxyMac.mm:
              * UIProcess/mac/TextCheckerMac.mm:
              * UIProcess/mac/WebContextMac.mm:
              * UIProcess/mac/WebContextMenuProxyMac.mm:
              * UIProcess/mac/WebPageProxyMac.mm:
              * UIProcess/mac/WebPopupMenuProxyMac.mm:
              * UIProcess/mac/WebPreferencesMac.mm:
              * WebProcess/Downloads/mac/DownloadMac.mm:
              * WebProcess/Plugins/Netscape/mac/NetscapePluginMac.mm:
              * WebProcess/Plugins/Netscape/mac/PluginProxyMac.mm:
              * WebProcess/WebCoreSupport/mac/WebContextMenuClientMac.mm:
              * WebProcess/WebCoreSupport/mac/WebDatabaseManagerMac.mm:
              * WebProcess/WebCoreSupport/mac/WebEditorClientMac.mm:
              * WebProcess/WebCoreSupport/mac/WebErrorsMac.mm:
              * WebProcess/WebCoreSupport/mac/WebPopupMenuMac.mm:
              * WebProcess/WebPage/mac/LayerBackedDrawingAreaMac.mm:
              * WebProcess/WebPage/mac/WebPageMac.mm:
              * WebProcess/mac/WebProcessMac.mm:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76418 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • mrowe@apple.com's avatar
      Fix the WebKit2 build with clang. · d82db12f
      mrowe@apple.com authored
      Reviewed by Sam Weinig.
      * Scripts/webkit2/messages.py: Add some more structs to the list.
      * UIProcess/DrawingAreaProxy.h: Forward-declare UpdateInfo as a class.
      * UIProcess/TextChecker.h: Forward-declare TextCheckerState as a struct.
      * UIProcess/WebPageProxy.h: Forward-declare ContextMenuState as a struct.
      * UIProcess/mac/TextCheckerMac.mm: Fix the type of the string constants so that they can be passed to
      functions expecting NSString* without generating warnings.
      * WebProcess/WebPage/DrawingArea.h: Forward-declare WebPageCreationParameters as a struct.
      * WebProcess/WebPage/DrawingAreaImpl.h: Forward-declare UpdateInfo as a class.
      * WebProcess/WebPage/WebPage.cpp:
      (WebKit::WebPage::getResourceDataFromFrame): Add parens around the assignment in the condition of
      the if statement to suppress a warning.
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76417 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • bweinstein@apple.com's avatar
      WebKit2: Need API to stop loading a WKFrame · c9643349
      bweinstein@apple.com authored
      Reviewed by Adam Roben.
      * UIProcess/API/C/WKFrame.cpp:
      (WKFrameStopLoading): Call through to WebFrameProxy::stopLoading.
      * UIProcess/API/C/WKFrame.h:
      * UIProcess/WebFrameProxy.cpp:
      (WebKit::WebFrameProxy::stopLoading): Send a message to the WebProcess to stop loading the frame
          with the passed in ID.
      * UIProcess/WebFrameProxy.h:
      * WebProcess/WebPage/WebPage.cpp:
      (WebKit::WebPage::stopLoadingFrame): Call stopForUserCancel on the passed-in frame.
      * WebProcess/WebPage/WebPage.h:
      * WebProcess/WebPage/WebPage.messages.in: Add StopLoadingFrame.
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76403 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • beidson@apple.com's avatar
      <rdar://problem/8894125> and https://bugs.webkit.org/show_bug.cgi?id=52916 · 40c86086
      beidson@apple.com authored
      Expose "suggested filename" for a resource based on its resource response.
      Reviewed by Adam Roben.
      API pieces:
      * WebProcess/InjectedBundle/API/c/WKBundleFrame.cpp:
      * WebProcess/InjectedBundle/API/c/WKBundleFrame.h:
      * WebProcess/WebPage/WebFrame.cpp:
      (WebKit::WebFrame::suggestedFilenameForResourceURL): See if the DocumentLoader has
        a resource for this URL and, if so, return the response's suggested filename.
      * WebProcess/WebPage/WebFrame.h:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76394 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • andersca@apple.com's avatar
      2011-01-21 Anders Carlsson <andersca@apple.com> · c5d43006
      andersca@apple.com authored
              Reviewed by Dan Bernstein.
              DrawingAreaProxyImpl::paint should return the unpainted region
              * UIProcess/API/mac/WKView.mm:
              (-[WKView drawRect:]):
              Add unpaintedRegion parameter.
              * UIProcess/BackingStore.h:
              Add a size getter.
              * UIProcess/DrawingAreaProxyImpl.cpp:
              Initialize the unpainted region to the dirty region, then subtract the painted region.
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76393 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • andersca@apple.com's avatar
      Fix for <rdar://problem/8896057> · f7d01d38
      andersca@apple.com authored
      Reviewed by Dan Bernstein and Maciej Stachowiak.
      Give the Web Process access to the PubSub agent.
      * WebProcess/com.apple.WebProcess.sb:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76391 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • weinig@apple.com's avatar
      Part 2 of "Cleanup Scrollbar/ScrollbarClient relationship" · d7d77c3e
      weinig@apple.com authored
      Reviewed by Anders Carlsson.
      Rename ScrollbarClient -> ScrollableArea.
      - Also replaces Scrollbar::setClient with Scrollbar::disconnectFromScrollableArea
        since that was its only use case.
      * CMakeLists.txt:
      * GNUmakefile.am:
      * WebCore.gypi:
      * WebCore.pro:
      * WebCore.vcproj/WebCore.vcproj:
      * WebCore.xcodeproj/project.pbxproj:
      * accessibility/AccessibilityScrollbar.cpp:
      * css/CSSStyleSelector.cpp:
      * page/FrameView.h:
      * platform/PopupMenuClient.h:
      * platform/ScrollAnimator.cpp:
      * platform/ScrollAnimator.h:
      * platform/ScrollAnimatorWin.cpp:
      * platform/ScrollAnimatorWin.h:
      * platform/ScrollView.cpp:
      * platform/ScrollView.h:
      * platform/ScrollableArea.cpp: Copied from WebCore/platform/ScrollbarClient.cpp.
      * platform/ScrollableArea.h: Copied from WebCore/platform/ScrollbarClient.h.
      * platform/Scrollbar.cpp:
      * platform/Scrollbar.h:
      * platform/ScrollbarClient.cpp: Removed.
      * platform/ScrollbarClient.h: Removed.
      * platform/ScrollbarThemeComposite.cpp:
      * platform/chromium/FramelessScrollView.h:
      * platform/chromium/ScrollbarThemeChromium.cpp:
      * platform/efl/ScrollbarEfl.cpp:
      * platform/efl/ScrollbarEfl.h:
      * platform/gtk/MainFrameScrollbarGtk.cpp:
      * platform/gtk/MainFrameScrollbarGtk.h:
      * platform/mac/ScrollAnimatorMac.h:
      * platform/mac/ScrollAnimatorMac.mm:
      * platform/mac/ScrollbarThemeMac.mm:
      * platform/qt/ScrollbarQt.cpp:
      * platform/win/PopupMenuWin.cpp:
      * platform/win/PopupMenuWin.h:
      * platform/win/ScrollbarThemeSafari.cpp:
      * platform/wx/ScrollbarThemeWx.cpp:
      * rendering/RenderDataGrid.h:
      * rendering/RenderLayer.cpp:
      * rendering/RenderLayer.h:
      * rendering/RenderListBox.cpp:
      * rendering/RenderListBox.h:
      * rendering/RenderMenuList.cpp:
      * rendering/RenderMenuList.h:
      * rendering/RenderScrollbar.cpp:
      * rendering/RenderScrollbar.h:
      * rendering/RenderTextControlSingleLine.cpp:
      * rendering/RenderTextControlSingleLine.h:
      * src/AutoFillPopupMenuClient.cpp:
      * src/AutoFillPopupMenuClient.h:
      * src/WebScrollbarImpl.cpp:
      * src/WebScrollbarImpl.h:
      * tests/PopupMenuTest.cpp:
      * Api/qwebframe.cpp:
      * WebScrollBar.cpp:
      * WebScrollBar.h:
      * UIProcess/win/WebPopupMenuProxyWin.cpp:
      * UIProcess/win/WebPopupMenuProxyWin.h:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76378 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • aroben@apple.com's avatar
      Rename WKCACFLayerRenderer[Client] to CACFLayerTreeHost[Client] · d0defa32
      aroben@apple.com authored
      Also renamed a few functions and data members to match.
      Fixes <http://webkit.org/b/52898> WKCACFLayerRenderer sounds like a render object, but isn't
      Reviewed by Simon Fraser.
      * WebCore.vcproj/WebCore.vcproj: Updated files' names and paths.
      * WebCore.vcproj/WebCoreQuartzCore.vsprops: Added platform/graphics/ca/win to the include
      * WebCore.vcproj/copyForwardingHeaders.cmd: Copy headers from platform/graphics/ca/win, too.
      * platform/graphics/ca/win/CACFLayerTreeHost.cpp: Renamed from Source/WebCore/platform/graphics/win/WKCACFLayerRenderer.cpp.
      * platform/graphics/ca/win/CACFLayerTreeHost.h: Renamed from Source/WebCore/platform/graphics/win/WKCACFLayerRenderer.h.
      * platform/graphics/ca/win/PlatformCALayerWin.cpp:
      * platform/graphics/win/MediaPlayerPrivateFullscreenWindow.cpp:
      * platform/graphics/win/MediaPlayerPrivateFullscreenWindow.h:
      Updated for renames.
      Update for WKCACFLayerRenderer -> CACFLayerTreeHost rename
      Also renamed WebView::m_layerRenderer to WebView::m_layerTreeHost to match.
      * WebPreferences.cpp:
      * WebView.cpp:
      (WebView::setAcceleratedCompositing): Also made sure to remove our HWND from the layer tree
      host before we get rid of the layer tree host itself.
      * WebView.h:
      Update for WKCACFLayerRenderer -> CACFLayerView rename
      * WebProcess/WebPage/win/LayerBackedDrawingAreaWin.cpp: Just removed all the unnecessary
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76370 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • darin@apple.com's avatar
      WebKit2: Implement showModalDialog · 3ed100bb
      darin@apple.com authored
      Reviewed by Dan Bernstein.
      * Shared/WebPageCreationParameters.h: Added canRunModal.
      * UIProcess/API/C/WKPage.h: Added a runModal function pointer to
      WKPageUIClient. Also removed a lot of redundant typedefs and added
      a new one, WKPageCallback, for callbacks without arguments or return
      * UIProcess/API/qt/qwkpage.cpp:
      (QWKPage::QWKPage): Added a runModal function pointer of 0.
      * UIProcess/WebPageProxy.cpp:
      (WebKit::WebPageProxy::creationParameters): Set canRunModal
      based on return value of WebUIClient::canRunModal.
      * UIProcess/WebPageProxy.h: Added runModal.
      Calls WebUIClient::runModal.
      * UIProcess/WebPageProxy.messages.in: Added RunModal message.
      Also removed the periods from the phrases in the comments
      as Maciej requested a while back.
      * UIProcess/WebUIClient.cpp:
      (WebKit::WebUIClient::canRunModal): Added. Returns true or false
      based on whether a runModal function was supplied in the
      WKPageUIClient structure.
      (WebKit::WebUIClient::runModal): Added. Calls the runModal
      function from the WKPageUIClient structure.
      * UIProcess/WebUIClient.h: Declared the above functions.
      * WebProcess/WebCoreSupport/WebChromeClient.cpp:
      (WebKit::WebChromeClient::canRunModal): Call through to WebPage.
      (WebKit::WebChromeClient::runModal): Ditto.
      * WebProcess/WebPage/WebPage.cpp:
      (WebKit::WebPage::WebPage): Initialize m_canRunModal based on the
      creation parameters. Initialize m_isRunningModal to false.
      (WebKit::WebPage::close): Stop the nested run loop if we are running modal.
      (WebKit::WebPage::runModal): Send a message to ask the UI process to run
      modal and then start a nested run loop. It gets stopped when the page is closed.
      * WebProcess/WebPage/WebPage.h: Defined the canRunModal function
      and declared the runModal function.
      This fixes WebKitTestRunner to compile, but more work is probably
      needed to get it to pass the tests.
      * WebKitTestRunner/TestController.cpp:
      (WTR::TestController::runModal): Added. Calls through to the
      platform-specific version of runModal.
      (WTR::TestController::createOtherPage): Changed to be a private
      static member function so it can refer to runModal, which is
      a private static member function.
      (WTR::TestController::initialize): Pass 0 for the runModal
      function since we don't need to run the main window modal.
      I suspect this is wrong and will need to change.
      * WebKitTestRunner/TestController.h: Added declarations for
      the functions added above.
      * WebKitTestRunner/mac/TestControllerMac.mm:
      (WTR::TestController::runModal): Added. Untested implementation.
      * WebKitTestRunner/qt/TestControllerQt.cpp:
      (WTR::TestController::runModal): Added.
      * WebKitTestRunner/win/TestControllerWin.cpp:
      (WTR::TestController::runModal): Added.
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76361 268f45cc-cd09-0410-ab3c-d52691b4dbfc
  3. 20 Jan, 2011 11 commits
    • ap@apple.com's avatar
      Reviewed by Darin Adler. · 02315226
      ap@apple.com authored
              Make window.print work with WebKit2
              * UIProcess/API/qt/qwkpage.cpp:
              * UIProcess/WebPageProxy.cpp:
              * UIProcess/WebPageProxy.h:
              * UIProcess/WebPageProxy.messages.in:
              * UIProcess/WebUIClient.cpp:
              * UIProcess/WebUIClient.h:
              * WebProcess/WebCoreSupport/WebChromeClient.cpp:
              Just pass through deelagte call to a WebKit2 client.
              * UIProcess/API/C/WKPage.h: Also added "Callback" suffix to other printing related function
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76306 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • andersca@apple.com's avatar
      2011-01-20 Anders Carlsson <andersca@apple.com> · f51f2f8a
      andersca@apple.com authored
              Reviewed by Darin Adler.
              Keep track of the latest update timestamp in the backing store
              * Shared/UpdateInfo.h:
              Initialize timestamp to 0.
              * UIProcess/BackingStore.cpp:
              Initialize m_latestUpdateTimestamp to 0.
              If the update is too old, discard it. Otherwise, create a bitmap
              and pass it to platformIncorporateUpdate. Finally update the timestamp.
              * UIProcess/BackingStore.h:
              Add m_latestUpdateTimestamp.
              * UIProcess/mac/BackingStoreMac.mm:
              Update now that we are already given the shareable bitmap.
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76305 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • bdakin@apple.com's avatar
      Fix for <rdar://problem/8890255> · f76bd26b
      bdakin@apple.com authored
      Reviewed by Geoffrey Garen.
      Allow WebKitSystemInterface to draw scrollbars 
      when appropriate.
      * WebCore.exp.in:
      * platform/mac/ScrollbarThemeMac.mm:
      (+[ScrollbarPrefsObserver appearancePrefsChanged:]):
      * platform/mac/WebCoreSystemInterface.h:
      * platform/mac/WebCoreSystemInterface.mm:
      Allow WebKitSystemInterface to draw scrollbars 
      when appropriate.
      * WebCoreSupport/WebSystemInterface.mm:
      Allow WebKitSystemInterface to draw scrollbars 
      when appropriate.
      * WebProcess/WebCoreSupport/mac/WebSystemInterface.mm:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76292 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • weinig@apple.com's avatar
      Cleanup Scrollbar/ScrollbarClient relationship · 2a13aa81
      weinig@apple.com authored
      Reviewed by Dave Hyatt.
      Pipe all scrolling through the ScrollbarClient/ScrollAnimator
      rather than through the Scrollbar. The Scrollbar now is just
      a "view" on the scroll position of the scrollable area it is
      attached to.
      There are now two ways to scroll a scrollable area:
      - ScrollbarClient::scroll()
      - ScrollbarClient::scrollToOffsetWithoutAnimation()
      Both of these go through the ScrollAnimator (updating its state
      or starting an animation). The ScrollAnimator, in turn, now calls
      ScrollbarClient::setScrollOffsetFromAnimation, which tells the
      Scrollbars to pull a new offset (via Scrollbar::offsetDidChange)
      and tells the class that derives from ScrollbarClient to scroll
      its contents (via ScrollbarClient::setScrollOffset).
      * WebCore.xcodeproj/project.pbxproj:
      Move Scrollbar.cpp to the right place.
      * accessibility/AccessibilityScrollbar.cpp:
      Initiate the scroll through the scrollbar client, rather than the
      scrollbar itself.
      * page/FrameView.cpp:
      * page/FrameView.h:
      Condense the two valueChanged overrides to a single override of the
      scrollTo function.
      * platform/ScrollAnimator.cpp:
      * platform/ScrollAnimator.h:
      * platform/ScrollAnimatorWin.cpp:
      * platform/ScrollAnimatorWin.h:
      * platform/mac/ScrollAnimatorMac.h:
      * platform/mac/ScrollAnimatorMac.mm:
      Change setScrollPositionAndStopAnimation to scrollToOffsetWithoutAnimation
      and bottleneck all client notification of changed position through a new
      notityPositionChanged() function.
      * platform/ScrollView.cpp:
      * platform/ScrollView.h:
      Update to scroll via the ScrollbarClient rather than the Scrollbar.
      * platform/Scrollbar.cpp:
      * platform/Scrollbar.h:
      Change the scrollbar to only updates its offset in response to
      an offsetDidChange call.
      * platform/ScrollbarClient.cpp:
      * platform/ScrollbarClient.h:
      Make the increasingly misnamed ScrollbarClient responsible for
      * platform/efl/ScrollbarEfl.cpp:
      * platform/gtk/MainFrameScrollbarGtk.cpp:
      * platform/qt/ScrollbarQt.cpp:
      Update to move scrolling through the client.
      * platform/win/PopupMenuWin.cpp:
      * platform/win/PopupMenuWin.h:
      * rendering/RenderLayer.cpp:
      * rendering/RenderLayer.h:
      * rendering/RenderListBox.cpp:
      * rendering/RenderListBox.h:
      Update to scroll via the ScrollbarClient rather than the Scrollbar.
      * rendering/RenderMarquee.cpp:
      Simplify initial paint to just do an immediate scroll to the position.
      * src/WebScrollbarImpl.cpp:
      * src/WebScrollbarImpl.h:
      * Api/qwebframe.cpp:
      * WebScrollBar.cpp:
      * WebScrollBar.h:
      * UIProcess/win/WebPopupMenuProxyWin.cpp:
      * UIProcess/win/WebPopupMenuProxyWin.h:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76291 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • andersca@apple.com's avatar
      2011-01-20 Anders Carlsson <andersca@apple.com> · 42abed10
      andersca@apple.com authored
              Reviewed by Adam Roben.
              Add a timestamp to UpdateInfo
              * Shared/UpdateInfo.cpp:
              * Shared/UpdateInfo.h:
              * WebProcess/WebPage/DrawingAreaImpl.cpp:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76285 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • andersca@apple.com's avatar
      2011-01-20 Anders Carlsson <andersca@apple.com> · 061b8ef0
      andersca@apple.com authored
              Reviewed by Beth Dakin.
              Add Connection::waitForAndDispatchImmediately
              * Platform/CoreIPC/Connection.h:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76280 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • kdecker@apple.com's avatar
      Reviewed by Anders Carlsson. · 562ac858
      kdecker@apple.com authored
              <rdar://problem/8880689> need a way to obtain the rendered rectangle for box elements
              * WebProcess/InjectedBundle/API/c/WKBundleNodeHandle.cpp:
              (WKBundleNodeHandleGetRenderRect): Added new method that will return a rendered rectangle for box elements
              * WebProcess/InjectedBundle/API/c/WKBundleNodeHandlePrivate.h: Ditto.
              * WebProcess/InjectedBundle/DOM/InjectedBundleNodeHandle.cpp: Ditto.
              (WebKit::InjectedBundleNodeHandle::renderRect): Ditto.
              * WebProcess/InjectedBundle/DOM/InjectedBundleNodeHandle.h: Ditto.
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76267 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • commit-queue@webkit.org's avatar
      2011-01-20 Kimmo Kinnunen <kimmo.t.kinnunen@nokia.com> · ab8d0167
      commit-queue@webkit.org authored
              Reviewed by Andreas Kling.
              Remove null ptr deref that happens when reattaching to
              a new web process.
              Implement didRelaunchProcess that sets the drawing area size
              after the drawing area is re-instantiated.
              [Qt][WK2] Null ptr deref in UI process after web process has crashed
              * UIProcess/API/qt/qgraphicswkview.cpp:
              * UIProcess/API/qt/qwkpage.cpp:
              (QWKPagePrivate::didRelaunchProcess): Reset drawing area size after crash.
              * UIProcess/API/qt/qwkpage_p.h:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76262 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • mjs@apple.com's avatar
      2011-01-20 Maciej Stachowiak <mjs@apple.com> · 7977a528
      mjs@apple.com authored
              Reviewed by Adam Roben.
              WebKitTestRunner needs to support layoutTestController.evaluateScriptInIsolatedWorld
              * platform/mac-wk2/Skipped: Unskip the tests that needed this.
      2011-01-20  Maciej Stachowiak  <mjs@apple.com>
              Reviewed by Adam Roben.
              WebKitTestRunner needs to support layoutTestController.evaluateScriptInIsolatedWorld
              Added a new API call, WKBundleFrameForJavaScriptContext, that gets the WKBundleFrameRef
              that corresponds to a JSContextRef (or null if none).
              * WebProcess/InjectedBundle/API/c/WKBundleFrame.cpp:
              (WKBundleFrameForJavaScriptContext): Simple wrapper, defers to a WebFrame
              static method.
              * WebProcess/InjectedBundle/API/c/WKBundleFrame.h:
              * WebProcess/WebPage/WebFrame.cpp:
              (WebKit::WebFrame::frameForContext): Follow the maze of twisty pointers.
              * WebProcess/WebPage/WebFrame.h:
      2011-01-20  Maciej Stachowiak  <mjs@apple.com>
              Reviewed by Adam Roben.
              WebKitTestRunner needs to support layoutTestController.evaluateScriptInIsolatedWorld
              * WebKitTestRunner/InjectedBundle/Bindings/CodeGeneratorTestRunner.pm: Add support
              for methods that take their normal arguments but also a JSContextRef.
              * WebKitTestRunner/InjectedBundle/Bindings/LayoutTestController.idl: IDL definition
              for evaluateScriptInIsolatedWorld.
              * WebKitTestRunner/InjectedBundle/InjectedBundlePage.cpp:
              (WTR::InjectedBundlePage::didClearWindowForFrame): Set a magic variable only if
              this call is for an isolated world.
              * WebKitTestRunner/InjectedBundle/LayoutTestController.cpp:
              (WTR::worldMap): Helper to create a world map.
              (WTR::LayoutTestController::worldIDForWorld): Map from an ID to a world.
              (WTR::LayoutTestController::evaluateScriptInIsolatedWorld): The newly
              added LayoutTestController API.
              * WebKitTestRunner/InjectedBundle/LayoutTestController.h:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76259 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • alex@webkit.org's avatar
      2011-01-20 Alejandro G. Castro <alex@igalia.com> · 252fa1d3
      alex@webkit.org authored
              Fix compilation error in GTK WebKit2.
              * Platform/CoreIPC/gtk/ConnectionGtk.cpp:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76252 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • ossy@webkit.org's avatar
      Refactoring of the custom allocation framework · 95c1bc42
      ossy@webkit.org authored
      Patch by Zoltan Horvath <zoltan@webkit.org> on 2011-01-20
      Reviewed by Csaba Osztrogonác.
      Inheriting from FastAllocBase can result in objects getting larger (bug #33896, #46589).
      The modification replaces Noncopyable and FastAllocBase classes and these inherits with their
      equivalent macro implementation at the necessary places.
      * wtf/FastAllocBase.h: Turn FastAllocBase's implementation into a macro.
      Inheriting from FastAllocBase can result in objects getting larger (bug #33896, #46589).
      The modification replaces Noncopyable and FastAllocBase classes and these inherits with their
      equivalent macro implementation at the necessary places.
      Inheriting from FastAllocBase can result in objects getting larger (bug #33896, #46589).
      The modification replaces Noncopyable and FastAllocBase classes and these inherits with their
      equivalent macro implementation at the n...
  4. 19 Jan, 2011 14 commits
    • simon.fraser@apple.com's avatar
      2011-01-19 Simon Fraser <simon.fraser@apple.com> · 52382a77
      simon.fraser@apple.com authored
              Fix the WebKit2 build.
              * WebProcess/WebPage/mac/LayerBackedDrawingAreaMac.mm:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76197 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • bweinstein@apple.com's avatar
      WebKit2: Need API to get the parent frame of a frame · a5c0fee2
      bweinstein@apple.com authored
      Reviewed by Darin Adler.
      Add the API to get the parent frame of a frame.
      * UIProcess/API/C/WKFrame.cpp:
      * UIProcess/API/C/WKFrame.h:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76188 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • enrica@apple.com's avatar
      WebKit2: add support for drag and drop · 3c5560ef
      enrica@apple.com authored
      Reviewed by Darin Adler.
      This patch contains the remaining work to support drag and drop on Mac.
      I've added a PasteboardTypes class to encapsulate all the pasteboard formats
      supported for drag and drop.
      In this implementation we don't support the promised types, since I could not
      find an efficient way to do this across processes.
      The bulk of the patch consists in creating a shareable bitmap for the drag image,
      pass its handle to the UI process and create a new NSImage from it to be given to
      AppKit for dragging.
      I've added the missing implementation of the methods in the drag client to hook
      up the placement of the data in the pasteboard.
      * Shared/mac/PasteboardTypes.h: Added.
      * Shared/mac/PasteboardTypes.mm: Added.
      * UIProcess/API/mac/PageClientImpl.h:
      * UIProcess/API/mac/PageClientImpl.mm:
      (WebKit::PageClientImpl::setDragImage): Added.
      * UIProcess/API/mac/WKView.mm:
      (-[WKView _registerDraggedTypes]): Refactored to use the new PasteboardTypes class.
      (-[WKView initWithFrame:contextRef:pageGroupRef:]):
      (-[WKView _setMouseDownEvent:]):
      (-[WKView _mouseHandler:]):
      (-[WKView mouseDown:]):
      (-[WKView mouseUp:]):
      (-[WKView mouseDragged:]):
      (-[WKView draggedImage:endedAt:operation:]):
      (-[WKView draggingEntered:]):
      (-[WKView _setDragImage:at:linkDrag:]):
      * UIProcess/API/mac/WKViewInternal.h:
      * UIProcess/PageClient.h:
      * UIProcess/WebPageProxy.cpp:
      * UIProcess/WebPageProxy.h:
      * UIProcess/WebPageProxy.messages.in:
      * WebKit2.xcodeproj/project.pbxproj:
      * WebProcess/WebCoreSupport/WebDragClient.cpp:
      * WebProcess/WebCoreSupport/WebDragClient.h:
      * WebProcess/WebCoreSupport/mac/WebDragClientMac.mm: Added.
      (WebKit::WebDragClient::startDrag): Added implementation.
      (WebKit::WebDragClient::createDragImageForLink): Ditto.
      (WebKit::writeURL): Helper function.
      (WebKit::writeImage): Helper function.
      (WebKit::WebDragClient::declareAndWriteDragImage): Added implementation.
      * WebProcess/WebPage/WebPage.cpp:
      * WebProcess/WebPage/WebPage.h:
      * WebProcess/WebPage/WebPage.messages.in:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76186 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • andersca@apple.com's avatar
      2011-01-19 Anders Carlsson <andersca@apple.com> · 6c3564b4
      andersca@apple.com authored
              Reviewed by Dan Bernstein.
              Put the deprecated Connection member functions next to eachother
              * Platform/CoreIPC/Connection.h:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76181 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • andersca@apple.com's avatar
      2011-01-19 Anders Carlsson <andersca@apple.com> · b29027e7
      andersca@apple.com authored
              Reviewed by Sam Weinig.
              When resizing, the web process should repaint the page
              * UIProcess/DrawingAreaProxyImpl.cpp:
              Incorporate the update.
              Return early if the update bounds rect is empty. This can happen if painting is
              disabled and we get a DidSetSize message.
              * WebProcess/WebPage/DrawingAreaImpl.cpp:
              If painting is disabled, just send back an empty UpdateInfo struct. Otherwise,
              paint and fill in the UpdateInfo struct.
              Assert that painting is not disabled.
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76179 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • ap@apple.com's avatar
      Reviewed by Darin Adler. · c44bd669
      ap@apple.com authored
              Make it possible for a WebKit2 client to print headers and footers
              * UIProcess/API/C/WKPage.h:
              * UIProcess/WebPageProxy.cpp:
              * UIProcess/WebPageProxy.h:
              * UIProcess/WebUIClient.cpp:
              * UIProcess/WebUIClient.h:
              Pass UIClient calls through.
              * UIProcess/API/mac/WKView.mm:
              (currentPrintOperationScale): A helper to extract scale factor from the current NSPrintOperation.
              (-[WKView _adjustPrintingMarginsForHeaderAndFooter]): Copied from WebKit1. Change current
              print info to account for header and footer height as provided by the client.
              (-[WKView knowsPageRange:]): Call -[self _adjustPrintingMarginsForHeaderAndFooter].
              (-[WKView drawPageBorderWithSize:]): When AppKit asks to print page border, call the client
              to do that. Code adapted form WebKit1.
              * UIProcess/API/qt/qwkpage:
              (QWKPage::QWKPage): Added zeroes for new WKPageUIClient members to avoid breaking the build.
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76167 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • jberlin@webkit.org's avatar
      Crash in WebDatabaseManagerProxy::getDatabaseOrigins when called after the WebProcess has · 2a7b7853
      jberlin@webkit.org authored
      died at least once
      Reviewed by Darin Adler.
      WebDatabaseManagerProxy::invalidate was setting m_webContext to 0, and invalidate gets
      called in WebContext::processDidClose. However, m_webContext is only set in the
      constructor, which is only called from the constructor of WebContext, so attempting to send
      a message to any new WebProcess after the first one died was causing a null deref.
      This patch moves setting m_webcontext into clearContext and clearContext is only called in
      the WebContext destructor.
      This patch also adds checks for a valid WebProcessProxy before attempting to send messages to
      the WebProcessProxy so that if the WebProcess has died and has not been revived, it does not
      attempt to dereference a null WebProcessProxy.
      * UIProcess/WebContext.cpp:
      Call WebDatabaseManagerProxy::clearContext.
      * UIProcess/WebContext.h:
      Make this method public so that it can be called from WebDatabaseManagerProxy.
      * UIProcess/WebDatabaseManagerProxy.cpp:
      If there isn't a valid process, invalidate the callback and return early.
      If tehre isn't a valid process return early.
      Move setting m_webContext to 0 from here ...
      * UIProcess/WebDatabaseManagerProxy.h:
      ... to here.
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76163 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • andersca@apple.com's avatar
      2011-01-19 Anders Carlsson <andersca@apple.com> · 89d89361
      andersca@apple.com authored
              Reviewed by Sam Weinig.
              Suspend/resume painting as the WKView visibility changes
              * UIProcess/DrawingAreaProxy.h:
              Add new member function. It should really be pure virtual once setPageIsVisible
              is removed.
              * UIProcess/DrawingAreaProxyImpl.cpp:
              Send SuspendPainting/ResumePainting messages based on whether the view is visible or not.
              Make this a stub; it should really be removed.
              * UIProcess/WebPageProxy.cpp:
              Call visibilityDidChange.
              * UIProcess/WebPageProxy.h:
              Add new getter.
              * WebProcess/WebPage/DrawingArea.messages.in:
              Add SuspendPainting and ResumePainting messages.
              * WebProcess/WebPage/DrawingAreaImpl.cpp:
              Initialize m_isPaintingSuspended.
              Set m_isPaintingSuspended to true and stop the display timer.
              Set m_isPaintingSuspended to false.
              Bail if m_isPaintingSuspended is true.
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76157 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • andreas.kling@nokia.com's avatar
      2011-01-19 Andreas Kling <kling@webkit.org> · eae89a4f
      andreas.kling@nokia.com authored
              Reviewed by Simon Hausmann.
              [Qt][WK2] Implement formatLocalizedString() for Qt.
              * WebProcess/WebCoreSupport/WebPlatformStrategies.cpp:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76149 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • andersca@apple.com's avatar
      2011-01-19 Chris Marrin <cmarrin@apple.com> · 80bbda7b
      andersca@apple.com authored
              Reviewed by Simon Fraser.
              WK2 - Multiple crashes in PlatformCALayer::replaceSublayer
              Added a hostingLayer as the parent of the existing drawingLayer.
              The hostingLayer is now the root which is passed to the 
              remote context. It never changes except to track the size
              of the window. The backingLayer is now a child of the 
              hostingLayer, which allow it to switch between tiled and
              I also now give back accurate settings for debug borders and
              repaint counters.
              * WebProcess/WebPage/LayerBackedDrawingArea.cpp:
              * WebProcess/WebPage/LayerBackedDrawingArea.h:
              * WebProcess/WebPage/mac/LayerBackedDrawingAreaMac.mm:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76143 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • cmarrin@apple.com's avatar
      2011-01-19 Chris Marrin <cmarrin@apple.com> · 1ee1d9dd
      cmarrin@apple.com authored
              Reviewed by Simon Fraser.
              WK2 - Multiple crashes in PlatformCALayer::replaceSublayer
              Added a hostingLayer as the parent of the existing drawingLayer.
              The hostingLayer is now the root which is passed to the 
              remote context. It never changes except to track the size
              of the window. The backingLayer is now a child of the 
              hostingLayer, which allow it to switch between tiled and
              I also now give back accurate settings for debug borders and
              repaint counters.
              * WebProcess/WebPage/LayerBackedDrawingArea.cpp:
              * WebProcess/WebPage/LayerBackedDrawingArea.h:
              * WebProcess/WebPage/mac/LayerBackedDrawingAreaMac.mm:
      2011-01-19  Chris Marrin  <cmarrin@apple.com>
              Reviewed by Simon Fraser.
              WK2 - Multiple crashes in PlatformCALayer::replaceSublayer
              Added ASSERTs to the places we assume a non-null superlayer.
              * platform/graphics/ca/GraphicsLayerCA.cpp:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76142 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • andersca@apple.com's avatar
      2011-01-19 Anders Carlsson <andersca@apple.com> · bb9a7620
      andersca@apple.com authored
              Reviewed by Darin Adler.
              Throttle sending of SetSize messages
              * UIProcess/DrawingAreaProxyImpl.cpp:
              Initialize m_isWaitingForDidSetSize to false.
              Null out the backing store.
              If m_isWaitingForDidSetSize is true, do nothing. Otherwise, set m_isWaitingForDidSetSize
              to true and send a SetSize message.
              * UIProcess/DrawingAreaProxyImpl.h:
              Add m_isWaitingForDidSetSize.
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76139 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • andersca@apple.com's avatar
      2011-01-19 Anders Carlsson <andersca@apple.com> · a5d54f73
      andersca@apple.com authored
              Reviewed by Darin Adler.
              Pass WebPageCreationParameters to DrawingArea::create
              * WebProcess/WebPage/DrawingArea.cpp:
              * WebProcess/WebPage/DrawingArea.h:
              * WebProcess/WebPage/DrawingAreaImpl.cpp:
              * WebProcess/WebPage/DrawingAreaImpl.h:
              * WebProcess/WebPage/WebPage.cpp:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76135 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • ossy@webkit.org's avatar
      [Qt] Remove unnecessary "../Source" from paths · bf546e66
      ossy@webkit.org authored
      after moving source files into Source is finished.
      Reviewed by Laszlo Gombos and Tor Arne Vestbø.
      * JavaScriptCore.pri:
      * WebCore.pri:
      * WebCore.pro:
      * Api/DerivedSources.pro:
      * DerivedSources.pro:
      * WebKit2.pro:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76122 268f45cc-cd09-0410-ab3c-d52691b4dbfc
  5. 18 Jan, 2011 4 commits
    • mjs@apple.com's avatar
      2011-01-18 Maciej Stachowiak <mjs@apple.com> · 54741f66
      mjs@apple.com authored
              Reviewed by Sam Weinig.
              WebKitTestRunner should track loading more like DumpRenderTree
              Change load tracking to track the current top loading frame, in the manner of DumpRenderTree.
              This makes some tests that call notifyDone multiple times pass.
              * WebKitTestRunner/InjectedBundle/InjectedBundle.cpp:
              * WebKitTestRunner/InjectedBundle/InjectedBundle.h:
              * WebKitTestRunner/InjectedBundle/InjectedBundlePage.cpp:
              * WebKitTestRunner/InjectedBundle/InjectedBundlePage.h:
              * WebKitTestRunner/InjectedBundle/LayoutTestController.cpp:
              * WebKitTestRunner/TestController.cpp:
      2011-01-18  Maciej Stachowiak  <mjs@apple.com>
              Reviewed by Sam Weinig.
              WebKitTestRunner should track loading more like DumpRenderTree
              Relax the message check in didSaveFrameToPageCache a bit more, since
              layout tests were still hitting the old one.
              * UIProcess/WebPageProxy.cpp:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76092 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • beidson@apple.com's avatar
      <rdar://problem/8860833> and https://bugs.webkit.org/show_bug.cgi?id=52599 · 0e7ea9b0
      beidson@apple.com authored
      UIProcess crash in WebPageProxy::reattachToWebProcess when web process crashes with a new tab/window.
      Reviewed by Darin Adler.
      * UIProcess/WebPageProxy.cpp:
      (WebKit::WebPageProxy::reattachToWebProcessWithItem): Null check item *both* places it is used.
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76089 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • beidson@apple.com's avatar
      <rdar://problem/8752200> and https://bugs.webkit.org/show_bug.cgi?id=52664 · 53329382
      beidson@apple.com authored
      Need WebKit2 API to asynchronously get the resource data for a URL
      Reviewed by Maciej Stachowiak. 
      Rename WKFrameGetMainResourceDataFunction to WKFrameGetResourceDataFunction, and add
      new API to get a resource by URL:
      * UIProcess/API/C/WKFrame.cpp:
      * UIProcess/API/C/WKFrame.h:
      Implement the new API in the UIProcess side:
      * UIProcess/WebFrameProxy.cpp:
      * UIProcess/WebFrameProxy.h:
      * UIProcess/WebPageProxy.cpp:
      * UIProcess/WebPageProxy.h:
      Have the WebProcess get the data and call back to the UIProcess:
      * WebProcess/WebPage/WebPage.cpp:
      * WebProcess/WebPage/WebPage.h:
      * WebProcess/WebPage/WebPage.messages.in:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76087 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • andersca@apple.com's avatar
      2011-01-18 Anders Carlsson <andersca@apple.com> · 7e17fdb5
      andersca@apple.com authored
              Reviewed by Dan Bernstein.
              Make PageClientImpl::scrollView do hardware blitting
              * UIProcess/API/mac/PageClientImpl.mm:
              Clip the scroll rect and scroll the view.
              * UIProcess/DrawingAreaProxyImpl.cpp:
              Scroll before painting.
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76086 268f45cc-cd09-0410-ab3c-d52691b4dbfc