1. 25 Jan, 2011 2 commits
  2. 24 Jan, 2011 14 commits
    • andersca@apple.com's avatar
      Fix build. · 2541c784
      andersca@apple.com authored
      * WebProcess/mac/WebProcessMac.mm:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76563 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • andersca@apple.com's avatar
      2011-01-24 Anders Carlsson <andersca@apple.com> · 34341a9c
      andersca@apple.com authored
              Reviewed by Dan Bernstein.
              Reset the page scale factor on standard frame loads
              Add a symbol needed by WebKit2.
              * WebCore.exp.in:
      2011-01-24  Anders Carlsson  <andersca@apple.com>
              Reviewed by Dan Bernstein.
              Reset the page scale factor on standard frame loads
              * UIProcess/WebPageProxy.cpp:
              Don't set m_viewScaleFactor here. It will be set in viewScaleFactorDidChange.
              Update m_viewScaleFactor.
              * UIProcess/WebPageProxy.h:
              Add viewScaleFactorDidChange.
              * UIProcess/WebPageProxy.messages.in:
              Add ViewScaleFactorDidChange message.
              * WebProcess/WebCoreSupport/WebFrameLoaderClient.cpp:
              Set the scale factor.
              Inform the UI process about the new view scale factor.
              * WebProcess/WebPage/WebPage.cpp:
              Send a ViewScaleFactorDidChange message.
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76561 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • mjs@apple.com's avatar
      2011-01-24 Maciej Stachowiak <mjs@apple.com> · 31a1ec3d
      mjs@apple.com authored
              Reviewed by Anders Carlsson.
              Use designated temp directory for the database for WebKit2
              Adopt the new WK2 API for this.
              * WebKitTestRunner/TestController.cpp:
              * WebKitTestRunner/TestController.h:
              * WebKitTestRunner/mac/TestControllerMac.mm:
              * WebKitTestRunner/qt/TestControllerQt.cpp:
              * WebKitTestRunner/win/TestControllerWin.cpp:
      2011-01-24  Maciej Stachowiak  <mjs@apple.com>
              Reviewed by Anders Carlsson.
              Use designated temp directory for the database for WebKit2
              Add the API necessary to support this. Database path is now
              determined on the UI process side and passed to the Web process.
              Reviewed by Anders Carlsson.
              * GNUmakefile.am:
              * Shared/WebProcessCreationParameters.cpp:
              * Shared/WebProcessCreationParameters.h:
              * UIProcess/API/C/WKContext.cpp:
              * UIProcess/API/C/WKContextPrivate.h:
              * UIProcess/WebContext.cpp:
              * UIProcess/WebContext.h:
              * UIProcess/mac/WebContextMac.mm:
              * UIProcess/qt/WebContextQt.cpp:
              * UIProcess/win/WebContextWin.cpp:
              * WebKit2.pro:
              * WebKit2.xcodeproj/project.pbxproj:
              * WebProcess/WebCoreSupport/WebDatabaseManager.cpp:
              * WebProcess/WebCoreSupport/WebDatabaseManager.h:
              * WebProcess/WebCoreSupport/gtk/WebDatabaseManagerGtk.cpp: Removed.
              * WebProcess/WebCoreSupport/mac/WebDatabaseManagerMac.mm: Removed.
              * WebProcess/WebCoreSupport/qt/WebDatabaseManagerQt.cpp: Removed.
              * WebProcess/WebCoreSupport/win/WebDatabaseManagerWin.cpp: Removed.
              * WebProcess/WebProcess.cpp:
              * WebProcess/com.apple.WebProcess.sb:
              * WebProcess/mac/WebProcessMac.mm:
              * win/WebKit2.vcproj:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76559 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • bfulgham@webkit.org's avatar
      Unreviewed build fix. · 86c7b54c
      bfulgham@webkit.org authored
      * win/WebKit2.vcproj: Don't build the CG Utilities when building
      without CG support.
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76551 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • andersca@apple.com's avatar
      2011-01-24 Anders Carlsson <andersca@apple.com> · e5926275
      andersca@apple.com authored
              Reviewed by John Sullivan.
              Don't use the timeout checker for non-user-interaction messages
              * UIProcess/ChunkedUpdateDrawingAreaProxy.cpp:
              * UIProcess/LayerBackedDrawingAreaProxy.cpp:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76550 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • aroben@apple.com's avatar
      Windows Production build fix · f4025fd1
      aroben@apple.com authored
      * JavaScriptCore.vcproj/JavaScriptCore.make: Update for move of JavaScriptCore into Source.
      * WebCore.vcproj/WebCore.make: Update for move of WebCore into Source.
      * WebKit.vcproj/WebKit.make: Update for move of WebKit into Source.
      * win/WebKit2.make: Update for move of WebKit2 into Source.
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76546 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • jberlin@webkit.org's avatar
      WebKit2: LayoutTests: The UNIMPLEMENTED warnings in TextCheckerWin should be disabled · b2f777a9
      jberlin@webkit.org authored
      Reviewed by Adam Roben.
      * UIProcess/win/TextCheckerWin.cpp:
      Disable the warnings for this file.
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76543 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • andersca@apple.com's avatar
      2011-01-24 Anders Carlsson <andersca@apple.com> · ebef3a29
      andersca@apple.com authored
              Reviewed by Sam Weinig.
              Wait for half a second if we're asked to paint when receiving a DidSetSize message
              * UIProcess/DrawingAreaProxyImpl.cpp:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76536 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • andersca@apple.com's avatar
      2011-01-24 Anders Carlsson <andersca@apple.com> · a31b9aaa
      andersca@apple.com authored
              Reviewed by Sam Weinig.
              Implement forceRedisplay in the new drawing area
              * WebProcess/WebPage/DrawingAreaImpl.cpp:
              * WebProcess/WebPage/DrawingAreaImpl.h:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76535 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • andersca@apple.com's avatar
      2011-01-24 Anders Carlsson <andersca@apple.com> · 6c85ea42
      andersca@apple.com authored
              Reviewed by Sam Weinig.
              Fill unpainted rects with the background color.
              * UIProcess/API/mac/WKView.mm:
              Add new helper function.
              (-[WKView drawRect:]):
              Iterate over the unpainted rects and fill them with the background color.
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76533 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • mitz@apple.com's avatar
      WebKit2 version of <rdar://problem/6097826> Mail's cursor does not become a... · a78d2f2f
      mitz@apple.com authored
      WebKit2 version of <rdar://problem/6097826> Mail's cursor does not become a resize cursor when moving mouse from scrolled email to the horizontal splitter
      Reviewed by John Sullivan.
      * UIProcess/API/mac/PageClientImpl.mm:
      (WebKit::PageClientImpl::setCursor): If the current cursor comes from a cursor rect, do not override it.
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76529 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • kbalazs@webkit.org's avatar
      Typo fix. · ff06a04e
      kbalazs@webkit.org authored
      Rubber-stamped by Csaba Osztrogonác.
      * UIProcess/Launcher/qt/ProcessLauncherQt.cpp:
      (WebKit::ProcessLauncher::launchProcess): Move the bracket to the right place.
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76520 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • commit-queue@webkit.org's avatar
      2011-01-24 Kimmo Kinnunen <kimmo.t.kinnunen@nokia.com> · 8e2795bd
      commit-queue@webkit.org authored
              Reviewed by Kenneth Rohde Christiansen.
              [Qt] Remove CleanupHandler by passing file descriptors.
              Deleting files in signal handler of UI process is not a good idea,
              because the memory where filenames are stored might not be valid
              after a crash.
              To avoid the need of using signal handlers for cleanup,
              change following:
                1) Avoid passing filenames between processes, pass fds
                2) When mmap'ing files, delete them immediately after
                   opening and mmap'ing them.
                3) Pass sockets with fds during fork+exec instead of
                   passing them via the filesystem.
                4) Use mmap'ed files for implementation of SharedMemory.
                   QSharedMemory does not support cleanup correctly.
                - Move MappedMemory to SharedMemory, make UpdateChunk use this.
                - Implement CoreIPC::Attachment using mmaped files.
                - Send messages using datagram socket. This solution works
                  similiarly to Mach ports on Mac.
                - Send big messages out-of-line and thus avoid increasing
                  the receive buffer.
                - Remove MemoryMappedPool and rely on libc/kernel caching
                  of mmapped areas.
                - Unmap memory areas after use.
                - When UI process crashes, kill the web process using SIGKILL.
                  This is possible again because cleanup handler is not needed.
              [WK2][Qt] Multiple problems with MemoryMappedPool
              * Platform/CoreIPC/Attachment.cpp:
              * Platform/CoreIPC/Attachment.h:
              * Platform/CoreIPC/Connection.h:
              * Platform/CoreIPC/qt/ConnectionQt.cpp:
              * Platform/SharedMemory.h:
              * Platform/WorkQueue.h:
              * Platform/qt/MappedMemoryPool.cpp: Removed.
              * Platform/qt/MappedMemoryPool.h: Removed.
              * Platform/qt/SharedMemoryQt.cpp:
              * Platform/qt/WorkQueueQt.cpp:
              * Shared/qt/UpdateChunk.cpp:
              * Shared/qt/UpdateChunk.h:
              * UIProcess/Launcher/ProcessLauncher.h:
              * UIProcess/Launcher/qt/ProcessLauncherQt.cpp:
              * UIProcess/Launcher/qt/ThreadLauncherQt.cpp:
              * WebKit2.pro:
              * WebProcess/qt/WebProcessMainQt.cpp:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76507 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • abecsi@webkit.org's avatar
      2011-01-24 Andras Becsi <abecsi@webkit.org> · 5c818c0c
      abecsi@webkit.org authored
              Reviewed by Csaba Osztrogonác.
              [Qt] Move project files into Source
              * Source/DerivedSources.pro: Copied from DerivedSources.pro.
              * Source/WebKit.pri: Renamed from WebKit.pri.
              * Source/WebKit.pro: Added.
              * Source/common.pri: Renamed from common.pri.
              * WebKit.pro: Removed.
      2011-01-24  Andras Becsi  <abecsi@webkit.org>
              Reviewed by Csaba Osztrogonác.
              [Qt] Move project files into Source
              * JavaScriptCore.pri:
              * JavaScriptCore.pro:
              * jsc.pro:
      2011-01-24  Andras Becsi  <abecsi@webkit.org>
              Reviewed by Csaba Osztrogonác.
              [Qt] Move project files into Source
              No new tests needed.
              * WebCore.pri:
              * WebCore.pro:
      2011-01-24  Andras Becsi  <abecsi@webkit.org>
  3. 23 Jan, 2011 2 commits
  4. 22 Jan, 2011 5 commits
    • andersca@apple.com's avatar
      2011-01-22 Anders Carlsson <andersca@apple.com> · 4beeebf5
      andersca@apple.com authored
              Reviewed by Sam Weinig.
              Transparent windows with compositing WebKit2 content show garbage
              * UIProcess/mac/LayerBackedDrawingAreaProxyMac.mm:
              If the WKView should draw transparent background, do so.
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76453 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • andersca@apple.com's avatar
      2011-01-22 Anders Carlsson <andersca@apple.com> · f3248c7d
      andersca@apple.com authored
              Reviewed by Sam Weinig.
              Add an asynchronous WKPageForceRepaint
              * UIProcess/API/C/WKPage.cpp:
              Call WebPageProxy::forceRepaint.
              * UIProcess/API/C/WKPage.h:
              Add WKPageForceRepaint.
              * UIProcess/GenericCallback.h:
              Add a "generic" VoidCallback class.
              * UIProcess/WebPageProxy.cpp:
              Insert the callback in the m_voidCallbacks map and send a forceRepaint message.
              Call the right void callback.
              Invalidate m_voidCallbacks.
              * UIProcess/WebPageProxy.messages.in:
              Add a VoidCallback message.
              * WebProcess/WebPage/ChunkedUpdateDrawingArea.cpp:
              Force a repaint.
              * WebProcess/WebPage/ChunkedUpdateDrawingArea.h:
              Add forceRepaint.
              * WebProcess/WebPage/WebPage.cpp:
              Call forceRepaint on the drawing area.
              * WebProcess/WebPage/WebPage.messages.in:
              Add a ForceRepaint message.
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76452 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • zimmermann@webkit.org's avatar
      2011-01-21 Nikolas Zimmermann <nzimmermann@rim.com> · e8433cca
      zimmermann@webkit.org authored
              Reviewed by Dirk Schulze.
              Introduce FontMetrics abstraction
              * src/ExternalPopupMenu.cpp: Use FontMetrics instead of Font to access the metrics.
              * src/WebFontImpl.cpp: Ditto.
      2011-01-21  Nikolas Zimmermann  <nzimmermann@rim.com>
              Reviewed by Dirk Schulze.
              Introduce FontMetrics abstraction
              * FullscreenVideoController.cpp: Use FontMetrics instead of Font to access the metrics.
              * WebCoreSupport/WebDragClient.cpp: Ditto.
              * WebKitGraphics.cpp: Ditto.
      2011-01-21  Nikolas Zimmermann  <nzimmermann@rim.com>
              Reviewed by Dirk Schulze.
              Introduce FontMetrics abstraction
              Encapsulate ascent/descent/lineHeight/lineGap methods in a single FontMetrics class, instead of
              having to define them in both Font & SimpleFontData. Changed to store floating point values
              as default, in order to get accurate information for small sized fonts. All these methods
              now have floating-point and integer versions. Whenever an integer variant of these functions
              is called, lroundf() is used to round the value.
              This makes it possible to support small font-sizes for SVG in a follow-up patch, as well
              as fixing rounding issues when using SVG Fonts.
              Shouldn't affect existing tests.
              * GNUmakefile.am: Add FontMetrics.h to build. 
              * WebCore.gypi: Ditto.
              * WebCore.pro: Ditto.
              * WebCore.vcproj/WebCore.vcproj: Ditto.
              * WebCore.xcodeproj/project.pbxproj: Ditto.
              * accessibility/gtk/AccessibilityObjectWrapperAtk.cpp: Use style->fontMetrics() instead of style->font() to access the metrics.
              * css/CSSPrimitiveValue.cpp:         
              * html/canvas/CanvasRenderingContext2D.cpp: Ditto.
              * inspector/InspectorController.cpp: Ditto.
              * platform/chromium/PopupMenuChromium.cpp: Ditto.
              * platform/graphics/Font.h: Remove ascent/descent/height/lineGap/lineSpacing/xHeight/unitsPerEm accessor...
              (WebCore::Font::fontMetrics): ... and only expose a single FontMetrics object here.
              * platform/graphics/FontFastPath.cpp: Use fontMetrics() to query metrics information.
              * platform/graphics/FontMetrics.h: Added.
              (WebCore::FontMetrics::FontMetrics): Creates a FontMetrics object, stored in SimpleFontData.
              (WebCore::FontMetrics::unitsPerEm): Returns an unsigned describing the unitsPerEm.
              (WebCore::FontMetrics::setUnitsPerEm): Sets the unitsPerEm value.
              (WebCore::FontMetrics::floatAscent): Returns the stored m_ascent float.
              (WebCore::FontMetrics::setAscent): Sets the stored m_ascent float.
              (WebCore::FontMetrics::floatDescent): Returns the stored m_descent float.
              (WebCore::FontMetrics::setDescent): Sets the stored m_descent float.
              (WebCore::FontMetrics::floatHeight): Returns floatAscent() + floatDescent().
              (WebCore::FontMetrics::floatLineGap): Returns the stored m_lineGap float.
              (WebCore::FontMetrics::setLineGap): Sets the stored m_lineGap float.
              (WebCore::FontMetrics::floatLineSpacing): Returns the stored m_lineSpacing float.
              (WebCore::FontMetrics::setLineSpacing): Sets the stored m_lineSpacing float.
              (WebCore::FontMetrics::xHeight): Returns the stored m_xHeight float (no integer version available, hence no 'float' prefix).
              (WebCore::FontMetrics::setXHeight): Sets the stored m_xHeight float.
              (WebCore::FontMetrics::ascent): Returns a rounded version of ascent().
              (WebCore::FontMetrics::descent): Ditto (for descent).
              (WebCore::FontMetrics::height): Returns ascent() + descent().
              (WebCore::FontMetrics::lineGap): Returns a rounded version of lineGap().
              (WebCore::FontMetrics::lineSpacing): Ditto (for lineSpacing).
              (WebCore::FontMetrics::reset): Nulls all members, used only by the platform variants of SimpleFontData.
              * platform/graphics/SimpleFontData.cpp: Adapt SVG Fonts code, to initialize the FontMetrics object, as the m_ascent/etc.. members are gone.
              * platform/graphics/SimpleFontData.h: Remove ascent/descent/height/lineSpacing/lineGap/xHeight/unitsPerEm accessors, and members, just store a FontMetrics object and expose it.
              * platform/graphics/chromium/FontChromiumWin.cpp: Use fontMetrics() to query font metrics.
              * platform/graphics/chromium/SimpleFontDataChromiumWin.cpp: Adapt platform code, to initialize the FontMetrics object.
              * platform/graphics/chromium/SimpleFontDataLinux.cpp: Ditto.
              * platform/graphics/chromium/UniscribeHelperTextRun.cpp: Use fontMetrics() to query font metrics.
              * platform/graphics/freetype/SimpleFontDataFreeType.cpp: Adapt platform code, to initialize the FontMetrics object.
              * platform/graphics/haiku/SimpleFontDataHaiku.cpp: Ditto.
              * platform/graphics/mac/FontComplexTextMac.cpp: Use fontMetrics() to query font metrics.
              * platform/graphics/mac/FontMac.mm: Ditto.
              * platform/graphics/mac/SimpleFontDataMac.mm: Adapt platform code, to initialize the FontMetrics object.
              * platform/graphics/pango/SimpleFontDataPango.cpp: Ditto.
              * platform/graphics/qt/SimpleFontDataQt.cpp: Ditto. (+ Switch to QFontMetricsF to get floating-point accurancy.)
              * platform/graphics/win/FontCGWin.cpp: Use fontMetrics() to query font metrics.
              * platform/graphics/win/FontWin.cpp: Ditto.
              * platform/graphics/win/SimpleFontDataCGWin.cpp: Adapt platform code, to initialize the FontMetrics object.
              * platform/graphics/win/SimpleFontDataCairoWin.cpp: Ditto.
              * platform/graphics/win/SimpleFontDataWin.cpp: Ditto.
              * platform/graphics/wince/GraphicsContextWinCE.cpp: Use fontMetrics() to query font metrics.
              * platform/graphics/wince/SimpleFontDataWinCE.cpp: Adapt platform code, to initialize the FontMetrics object.
              * platform/graphics/wx/SimpleFontDataWx.cpp: Ditto.
              * platform/win/PopupMenuWin.cpp: Use style->fontMetrics() instead of style->font() to access the metrics.
              * rendering/EllipsisBox.cpp: Ditto.
              * rendering/InlineBox.cpp: Ditto.
              * rendering/InlineFlowBox.cpp: Ditto.
              * rendering/InlineTextBox.cpp: Ditto.
              * rendering/RenderBlock.cpp: Ditto.
              * rendering/RenderBox.cpp: Ditto.
              * rendering/RenderEmbeddedObject.cpp: Ditto.
              * rendering/RenderImage.cpp: Ditto.
              * rendering/RenderInline.cpp: Ditto.
              * rendering/RenderListBox.cpp: Ditto.
              * rendering/RenderListMarker.cpp: Ditto.
              * rendering/RenderTextControl.cpp: Ditto.
              * rendering/RenderTextControlSingleLine.cpp: Ditto.
              * rendering/RenderThemeWin.cpp: Ditto.
              * rendering/mathml/RenderMathMLFraction.cpp: Ditto.
              * rendering/style/RenderStyle.h: Add "const FontMetrics& fontMetrics() const" accessor.
              * rendering/svg/RenderSVGInlineText.cpp: Use style->fontMetrics() instead of style->font() to access the metrics.
              * rendering/svg/SVGInlineTextBox.cpp: Ditto.
              * rendering/svg/SVGTextLayoutEngineBaseline.cpp: Ditto.
              * rendering/svg/SVGTextLayoutEngineSpacing.cpp: Ditto.
              * rendering/svg/SVGTextMetrics.cpp: Ditto.
              * rendering/svg/SVGTextQuery.cpp: Ditto.
              * svg/SVGFontFaceElement.cpp: 
              (WebCore::SVGFontFaceElement::unitsPerEm): Rename defaultUnitsPerEm global to gDefaultUnitsPerEm.
              * svg/SVGLength.cpp: Use style->fontMetrics() instead of style->font() to access the metrics.
      2011-01-21  Nikolas Zimmermann  <nzimmermann@rim.com>
              Reviewed by Dirk Schulze.
              Introduce FontMetrics abstraction
              * WebProcess/WebCoreSupport/win/WebPopupMenuWin.cpp: Use FontMetrics instead of Font to access the metrics.
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76442 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • ap@apple.com's avatar
      2011-01-22 Alexey Proskuryakov <ap@apple.com> · 92c70bde
      ap@apple.com authored
              Reviewed by Dan Bernstein.
              Leak in WebPage::drawRectToPDF
              * WebProcess/WebPage/WebPage.cpp: (WebKit::WebPage::drawRectToPDF): Use RetainPtr here, too.
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76434 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • ap@apple.com's avatar
      2011-01-22 Alexey Proskuryakov <ap@apple.com> · 1260e1d1
      ap@apple.com authored
              Reviewed by Dan Bernstein.
              WebKit2 generates a bad PDF for cross process messaging
              * page/PrintContext.cpp: (WebCore::PrintContext::spoolRect): Use a correct offset to actually
              draw inside the requested rectangle.
      2011-01-22  Alexey Proskuryakov  <ap@apple.com>
              Reviewed by Dan Bernstein.
              WebKit2 generates a bad PDF for cross process messaging
              * UIProcess/API/mac/WKView.mm:
              (-[WKView _recursiveDisplayRectIfNeededIgnoringOpacity:isVisibleRect:rectIsVisibleRectForView:topView:]):
              Use a correct offset when flipping.
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76433 268f45cc-cd09-0410-ab3c-d52691b4dbfc
  5. 21 Jan, 2011 9 commits
    • ap@apple.com's avatar
      Reviewed by Dan Bernstein. · 9d1b66c3
      ap@apple.com authored
              Objective-C files should use #import, not #include
              * UIProcess/API/C/WebKit2.h: This is an interesting one, because it's cross-platform, and
              there is more than one WKView.h.
              * Platform/mac/ModuleMac.mm:
              * Platform/mac/RunLoopMac.mm:
              * PluginProcess/mac/PluginControllerProxyMac.mm:
              * PluginProcess/mac/PluginProcessMac.mm:
              * PluginProcess/mac/PluginProcessMainMac.mm:
              * Shared/API/c/mac/WKCertificateInfoMac.mm:
              * Shared/API/c/mac/WKURLRequestNS.mm:
              * Shared/API/c/mac/WKURLResponseNS.mm:
              * Shared/Plugins/Netscape/mac/NetscapePluginModuleMac.mm:
              * Shared/mac/PlatformCertificateInfo.mm:
              * Shared/mac/SandboxExtensionMac.mm:
              * Shared/mac/WebCoreArgumentCodersMac.mm:
              * Shared/mac/WebMemorySampler.mac.mm:
              * Shared/mac/WebURLRequestMac.mm:
              * Shared/mac/WebURLResponseMac.mm:
              * UIProcess/API/mac/FindIndicatorWindow.mm:
              * UIProcess/API/mac/WKTextInputWindowController.mm:
              * UIProcess/Launcher/mac/ProcessLauncherMac.mm:
              * UIProcess/Launcher/mac/ThreadLauncherMac.mm:
              * UIProcess/Plugins/mac/PluginInfoStoreMac.mm:
              * UIProcess/Plugins/mac/PluginProcessProxyMac.mm:
              * UIProcess/mac/BackingStoreMac.mm:
              * UIProcess/mac/ChunkedUpdateDrawingAreaProxyMac.mm:
              * UIProcess/mac/LayerBackedDrawingAreaProxyMac.mm:
              * UIProcess/mac/TextCheckerMac.mm:
              * UIProcess/mac/WebContextMac.mm:
              * UIProcess/mac/WebContextMenuProxyMac.mm:
              * UIProcess/mac/WebPageProxyMac.mm:
              * UIProcess/mac/WebPopupMenuProxyMac.mm:
              * UIProcess/mac/WebPreferencesMac.mm:
              * WebProcess/Downloads/mac/DownloadMac.mm:
              * WebProcess/Plugins/Netscape/mac/NetscapePluginMac.mm:
              * WebProcess/Plugins/Netscape/mac/PluginProxyMac.mm:
              * WebProcess/WebCoreSupport/mac/WebContextMenuClientMac.mm:
              * WebProcess/WebCoreSupport/mac/WebDatabaseManagerMac.mm:
              * WebProcess/WebCoreSupport/mac/WebEditorClientMac.mm:
              * WebProcess/WebCoreSupport/mac/WebErrorsMac.mm:
              * WebProcess/WebCoreSupport/mac/WebPopupMenuMac.mm:
              * WebProcess/WebPage/mac/LayerBackedDrawingAreaMac.mm:
              * WebProcess/WebPage/mac/WebPageMac.mm:
              * WebProcess/mac/WebProcessMac.mm:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76418 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • mrowe@apple.com's avatar
      Fix the WebKit2 build with clang. · d82db12f
      mrowe@apple.com authored
      Reviewed by Sam Weinig.
      * Scripts/webkit2/messages.py: Add some more structs to the list.
      * UIProcess/DrawingAreaProxy.h: Forward-declare UpdateInfo as a class.
      * UIProcess/TextChecker.h: Forward-declare TextCheckerState as a struct.
      * UIProcess/WebPageProxy.h: Forward-declare ContextMenuState as a struct.
      * UIProcess/mac/TextCheckerMac.mm: Fix the type of the string constants so that they can be passed to
      functions expecting NSString* without generating warnings.
      * WebProcess/WebPage/DrawingArea.h: Forward-declare WebPageCreationParameters as a struct.
      * WebProcess/WebPage/DrawingAreaImpl.h: Forward-declare UpdateInfo as a class.
      * WebProcess/WebPage/WebPage.cpp:
      (WebKit::WebPage::getResourceDataFromFrame): Add parens around the assignment in the condition of
      the if statement to suppress a warning.
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76417 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • bweinstein@apple.com's avatar
      WebKit2: Need API to stop loading a WKFrame · c9643349
      bweinstein@apple.com authored
      Reviewed by Adam Roben.
      * UIProcess/API/C/WKFrame.cpp:
      (WKFrameStopLoading): Call through to WebFrameProxy::stopLoading.
      * UIProcess/API/C/WKFrame.h:
      * UIProcess/WebFrameProxy.cpp:
      (WebKit::WebFrameProxy::stopLoading): Send a message to the WebProcess to stop loading the frame
          with the passed in ID.
      * UIProcess/WebFrameProxy.h:
      * WebProcess/WebPage/WebPage.cpp:
      (WebKit::WebPage::stopLoadingFrame): Call stopForUserCancel on the passed-in frame.
      * WebProcess/WebPage/WebPage.h:
      * WebProcess/WebPage/WebPage.messages.in: Add StopLoadingFrame.
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76403 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • beidson@apple.com's avatar
      <rdar://problem/8894125> and https://bugs.webkit.org/show_bug.cgi?id=52916 · 40c86086
      beidson@apple.com authored
      Expose "suggested filename" for a resource based on its resource response.
      Reviewed by Adam Roben.
      API pieces:
      * WebProcess/InjectedBundle/API/c/WKBundleFrame.cpp:
      * WebProcess/InjectedBundle/API/c/WKBundleFrame.h:
      * WebProcess/WebPage/WebFrame.cpp:
      (WebKit::WebFrame::suggestedFilenameForResourceURL): See if the DocumentLoader has
        a resource for this URL and, if so, return the response's suggested filename.
      * WebProcess/WebPage/WebFrame.h:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76394 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • andersca@apple.com's avatar
      2011-01-21 Anders Carlsson <andersca@apple.com> · c5d43006
      andersca@apple.com authored
              Reviewed by Dan Bernstein.
              DrawingAreaProxyImpl::paint should return the unpainted region
              * UIProcess/API/mac/WKView.mm:
              (-[WKView drawRect:]):
              Add unpaintedRegion parameter.
              * UIProcess/BackingStore.h:
              Add a size getter.
              * UIProcess/DrawingAreaProxyImpl.cpp:
              Initialize the unpainted region to the dirty region, then subtract the painted region.
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76393 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • andersca@apple.com's avatar
      Fix for <rdar://problem/8896057> · f7d01d38
      andersca@apple.com authored
      Reviewed by Dan Bernstein and Maciej Stachowiak.
      Give the Web Process access to the PubSub agent.
      * WebProcess/com.apple.WebProcess.sb:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76391 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • weinig@apple.com's avatar
      Part 2 of "Cleanup Scrollbar/ScrollbarClient relationship" · d7d77c3e
      weinig@apple.com authored
      Reviewed by Anders Carlsson.
      Rename ScrollbarClient -> ScrollableArea.
      - Also replaces Scrollbar::setClient with Scrollbar::disconnectFromScrollableArea
        since that was its only use case.
      * CMakeLists.txt:
      * GNUmakefile.am:
      * WebCore.gypi:
      * WebCore.pro:
      * WebCore.vcproj/WebCore.vcproj:
      * WebCore.xcodeproj/project.pbxproj:
      * accessibility/AccessibilityScrollbar.cpp:
      * css/CSSStyleSelector.cpp:
      * page/FrameView.h:
      * platform/PopupMenuClient.h:
      * platform/ScrollAnimator.cpp:
      * platform/ScrollAnimator.h:
      * platform/ScrollAnimatorWin.cpp:
      * platform/ScrollAnimatorWin.h:
      * platform/ScrollView.cpp:
      * platform/ScrollView.h:
      * platform/ScrollableArea.cpp: Copied from WebCore/platform/ScrollbarClient.cpp.
      * platform/ScrollableArea.h: Copied from WebCore/platform/ScrollbarClient.h.
      * platform/Scrollbar.cpp:
      * platform/Scrollbar.h:
      * platform/ScrollbarClient.cpp: Removed.
      * platform/ScrollbarClient.h: Removed.
      * platform/ScrollbarThemeComposite.cpp:
      * platform/chromium/FramelessScrollView.h:
      * platform/chromium/ScrollbarThemeChromium.cpp:
      * platform/efl/ScrollbarEfl.cpp:
      * platform/efl/ScrollbarEfl.h:
      * platform/gtk/MainFrameScrollbarGtk.cpp:
      * platform/gtk/MainFrameScrollbarGtk.h:
      * platform/mac/ScrollAnimatorMac.h:
      * platform/mac/ScrollAnimatorMac.mm:
      * platform/mac/ScrollbarThemeMac.mm:
      * platform/qt/ScrollbarQt.cpp:
      * platform/win/PopupMenuWin.cpp:
      * platform/win/PopupMenuWin.h:
      * platform/win/ScrollbarThemeSafari.cpp:
      * platform/wx/ScrollbarThemeWx.cpp:
      * rendering/RenderDataGrid.h:
      * rendering/RenderLayer.cpp:
      * rendering/RenderLayer.h:
      * rendering/RenderListBox.cpp:
      * rendering/RenderListBox.h:
      * rendering/RenderMenuList.cpp:
      * rendering/RenderMenuList.h:
      * rendering/RenderScrollbar.cpp:
      * rendering/RenderScrollbar.h:
      * rendering/RenderTextControlSingleLine.cpp:
      * rendering/RenderTextControlSingleLine.h:
      * src/AutoFillPopupMenuClient.cpp:
      * src/AutoFillPopupMenuClient.h:
      * src/WebScrollbarImpl.cpp:
      * src/WebScrollbarImpl.h:
      * tests/PopupMenuTest.cpp:
      * Api/qwebframe.cpp:
      * WebScrollBar.cpp:
      * WebScrollBar.h:
      * UIProcess/win/WebPopupMenuProxyWin.cpp:
      * UIProcess/win/WebPopupMenuProxyWin.h:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76378 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • aroben@apple.com's avatar
      Rename WKCACFLayerRenderer[Client] to CACFLayerTreeHost[Client] · d0defa32
      aroben@apple.com authored
      Also renamed a few functions and data members to match.
      Fixes <http://webkit.org/b/52898> WKCACFLayerRenderer sounds like a render object, but isn't
      Reviewed by Simon Fraser.
      * WebCore.vcproj/WebCore.vcproj: Updated files' names and paths.
      * WebCore.vcproj/WebCoreQuartzCore.vsprops: Added platform/graphics/ca/win to the include
      * WebCore.vcproj/copyForwardingHeaders.cmd: Copy headers from platform/graphics/ca/win, too.
      * platform/graphics/ca/win/CACFLayerTreeHost.cpp: Renamed from Source/WebCore/platform/graphics/win/WKCACFLayerRenderer.cpp.
      * platform/graphics/ca/win/CACFLayerTreeHost.h: Renamed from Source/WebCore/platform/graphics/win/WKCACFLayerRenderer.h.
      * platform/graphics/ca/win/PlatformCALayerWin.cpp:
      * platform/graphics/win/MediaPlayerPrivateFullscreenWindow.cpp:
      * platform/graphics/win/MediaPlayerPrivateFullscreenWindow.h:
      Updated for renames.
      Update for WKCACFLayerRenderer -> CACFLayerTreeHost rename
      Also renamed WebView::m_layerRenderer to WebView::m_layerTreeHost to match.
      * WebPreferences.cpp:
      * WebView.cpp:
      (WebView::setAcceleratedCompositing): Also made sure to remove our HWND from the layer tree
      host before we get rid of the layer tree host itself.
      * WebView.h:
      Update for WKCACFLayerRenderer -> CACFLayerView rename
      * WebProcess/WebPage/win/LayerBackedDrawingAreaWin.cpp: Just removed all the unnecessary
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76370 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • darin@apple.com's avatar
      WebKit2: Implement showModalDialog · 3ed100bb
      darin@apple.com authored
      Reviewed by Dan Bernstein.
      * Shared/WebPageCreationParameters.h: Added canRunModal.
      * UIProcess/API/C/WKPage.h: Added a runModal function pointer to
      WKPageUIClient. Also removed a lot of redundant typedefs and added
      a new one, WKPageCallback, for callbacks without arguments or return
      * UIProcess/API/qt/qwkpage.cpp:
      (QWKPage::QWKPage): Added a runModal function pointer of 0.
      * UIProcess/WebPageProxy.cpp:
      (WebKit::WebPageProxy::creationParameters): Set canRunModal
      based on return value of WebUIClient::canRunModal.
      * UIProcess/WebPageProxy.h: Added runModal.
      Calls WebUIClient::runModal.
      * UIProcess/WebPageProxy.messages.in: Added RunModal message.
      Also removed the periods from the phrases in the comments
      as Maciej requested a while back.
      * UIProcess/WebUIClient.cpp:
      (WebKit::WebUIClient::canRunModal): Added. Returns true or false
      based on whether a runModal function was supplied in the
      WKPageUIClient structure.
      (WebKit::WebUIClient::runModal): Added. Calls the runModal
      function from the WKPageUIClient structure.
      * UIProcess/WebUIClient.h: Declared the above functions.
      * WebProcess/WebCoreSupport/WebChromeClient.cpp:
      (WebKit::WebChromeClient::canRunModal): Call through to WebPage.
      (WebKit::WebChromeClient::runModal): Ditto.
      * WebProcess/WebPage/WebPage.cpp:
      (WebKit::WebPage::WebPage): Initialize m_canRunModal based on the
      creation parameters. Initialize m_isRunningModal to false.
      (WebKit::WebPage::close): Stop the nested run loop if we are running modal.
      (WebKit::WebPage::runModal): Send a message to ask the UI process to run
      modal and then start a nested run loop. It gets stopped when the page is closed.
      * WebProcess/WebPage/WebPage.h: Defined the canRunModal function
      and declared the runModal function.
      This fixes WebKitTestRunner to compile, but more work is probably
      needed to get it to pass the tests.
      * WebKitTestRunner/TestController.cpp:
      (WTR::TestController::runModal): Added. Calls through to the
      platform-specific version of runModal.
      (WTR::TestController::createOtherPage): Changed to be a private
      static member function so it can refer to runModal, which is
      a private static member function.
      (WTR::TestController::initialize): Pass 0 for the runModal
      function since we don't need to run the main window modal.
      I suspect this is wrong and will need to change.
      * WebKitTestRunner/TestController.h: Added declarations for
      the functions added above.
      * WebKitTestRunner/mac/TestControllerMac.mm:
      (WTR::TestController::runModal): Added. Untested implementation.
      * WebKitTestRunner/qt/TestControllerQt.cpp:
      (WTR::TestController::runModal): Added.
      * WebKitTestRunner/win/TestControllerWin.cpp:
      (WTR::TestController::runModal): Added.
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76361 268f45cc-cd09-0410-ab3c-d52691b4dbfc
  6. 20 Jan, 2011 8 commits
    • ap@apple.com's avatar
      Reviewed by Darin Adler. · 02315226
      ap@apple.com authored
              Make window.print work with WebKit2
              * UIProcess/API/qt/qwkpage.cpp:
              * UIProcess/WebPageProxy.cpp:
              * UIProcess/WebPageProxy.h:
              * UIProcess/WebPageProxy.messages.in:
              * UIProcess/WebUIClient.cpp:
              * UIProcess/WebUIClient.h:
              * WebProcess/WebCoreSupport/WebChromeClient.cpp:
              Just pass through deelagte call to a WebKit2 client.
              * UIProcess/API/C/WKPage.h: Also added "Callback" suffix to other printing related function
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76306 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • andersca@apple.com's avatar
      2011-01-20 Anders Carlsson <andersca@apple.com> · f51f2f8a
      andersca@apple.com authored
              Reviewed by Darin Adler.
              Keep track of the latest update timestamp in the backing store
              * Shared/UpdateInfo.h:
              Initialize timestamp to 0.
              * UIProcess/BackingStore.cpp:
              Initialize m_latestUpdateTimestamp to 0.
              If the update is too old, discard it. Otherwise, create a bitmap
              and pass it to platformIncorporateUpdate. Finally update the timestamp.
              * UIProcess/BackingStore.h:
              Add m_latestUpdateTimestamp.
              * UIProcess/mac/BackingStoreMac.mm:
              Update now that we are already given the shareable bitmap.
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76305 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • bdakin@apple.com's avatar
      Fix for <rdar://problem/8890255> · f76bd26b
      bdakin@apple.com authored
      Reviewed by Geoffrey Garen.
      Allow WebKitSystemInterface to draw scrollbars 
      when appropriate.
      * WebCore.exp.in:
      * platform/mac/ScrollbarThemeMac.mm:
      (+[ScrollbarPrefsObserver appearancePrefsChanged:]):
      * platform/mac/WebCoreSystemInterface.h:
      * platform/mac/WebCoreSystemInterface.mm:
      Allow WebKitSystemInterface to draw scrollbars 
      when appropriate.
      * WebCoreSupport/WebSystemInterface.mm:
      Allow WebKitSystemInterface to draw scrollbars 
      when appropriate.
      * WebProcess/WebCoreSupport/mac/WebSystemInterface.mm:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76292 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • weinig@apple.com's avatar
      Cleanup Scrollbar/ScrollbarClient relationship · 2a13aa81
      weinig@apple.com authored
      Reviewed by Dave Hyatt.
      Pipe all scrolling through the ScrollbarClient/ScrollAnimator
      rather than through the Scrollbar. The Scrollbar now is just
      a "view" on the scroll position of the scrollable area it is
      attached to.
      There are now two ways to scroll a scrollable area:
      - ScrollbarClient::scroll()
      - ScrollbarClient::scrollToOffsetWithoutAnimation()
      Both of these go through the ScrollAnimator (updating its state
      or starting an animation). The ScrollAnimator, in turn, now calls
      ScrollbarClient::setScrollOffsetFromAnimation, which tells the
      Scrollbars to pull a new offset (via Scrollbar::offsetDidChange)
      and tells the class that derives from ScrollbarClient to scroll
      its contents (via ScrollbarClient::setScrollOffset).
      * WebCore.xcodeproj/project.pbxproj:
      Move Scrollbar.cpp to the right place.
      * accessibility/AccessibilityScrollbar.cpp:
      Initiate the scroll through the scrollbar client, rather than the
      scrollbar itself.
      * page/FrameView.cpp:
      * page/FrameView.h:
      Condense the two valueChanged overrides to a single override of the
      scrollTo function.
      * platform/ScrollAnimator.cpp:
      * platform/ScrollAnimator.h:
      * platform/ScrollAnimatorWin.cpp:
      * platform/ScrollAnimatorWin.h:
      * platform/mac/ScrollAnimatorMac.h:
      * platform/mac/ScrollAnimatorMac.mm:
      Change setScrollPositionAndStopAnimation to scrollToOffsetWithoutAnimation
      and bottleneck all client notification of changed position through a new
      notityPositionChanged() function.
      * platform/ScrollView.cpp:
      * platform/ScrollView.h:
      Update to scroll via the ScrollbarClient rather than the Scrollbar.
      * platform/Scrollbar.cpp:
      * platform/Scrollbar.h:
      Change the scrollbar to only updates its offset in response to
      an offsetDidChange call.
      * platform/ScrollbarClient.cpp:
      * platform/ScrollbarClient.h:
      Make the increasingly misnamed ScrollbarClient responsible for
      * platform/efl/ScrollbarEfl.cpp:
      * platform/gtk/MainFrameScrollbarGtk.cpp:
      * platform/qt/ScrollbarQt.cpp:
      Update to move scrolling through the client.
      * platform/win/PopupMenuWin.cpp:
      * platform/win/PopupMenuWin.h:
      * rendering/RenderLayer.cpp:
      * rendering/RenderLayer.h:
      * rendering/RenderListBox.cpp:
      * rendering/RenderListBox.h:
      Update to scroll via the ScrollbarClient rather than the Scrollbar.
      * rendering/RenderMarquee.cpp:
      Simplify initial paint to just do an immediate scroll to the position.
      * src/WebScrollbarImpl.cpp:
      * src/WebScrollbarImpl.h:
      * Api/qwebframe.cpp:
      * WebScrollBar.cpp:
      * WebScrollBar.h:
      * UIProcess/win/WebPopupMenuProxyWin.cpp:
      * UIProcess/win/WebPopupMenuProxyWin.h:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76291 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • andersca@apple.com's avatar
      2011-01-20 Anders Carlsson <andersca@apple.com> · 42abed10
      andersca@apple.com authored
              Reviewed by Adam Roben.
              Add a timestamp to UpdateInfo
              * Shared/UpdateInfo.cpp:
              * Shared/UpdateInfo.h:
              * WebProcess/WebPage/DrawingAreaImpl.cpp:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76285 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • andersca@apple.com's avatar
      2011-01-20 Anders Carlsson <andersca@apple.com> · 061b8ef0
      andersca@apple.com authored
              Reviewed by Beth Dakin.
              Add Connection::waitForAndDispatchImmediately
              * Platform/CoreIPC/Connection.h:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76280 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • kdecker@apple.com's avatar
      Reviewed by Anders Carlsson. · 562ac858
      kdecker@apple.com authored
              <rdar://problem/8880689> need a way to obtain the rendered rectangle for box elements
              * WebProcess/InjectedBundle/API/c/WKBundleNodeHandle.cpp:
              (WKBundleNodeHandleGetRenderRect): Added new method that will return a rendered rectangle for box elements
              * WebProcess/InjectedBundle/API/c/WKBundleNodeHandlePrivate.h: Ditto.
              * WebProcess/InjectedBundle/DOM/InjectedBundleNodeHandle.cpp: Ditto.
              (WebKit::InjectedBundleNodeHandle::renderRect): Ditto.
              * WebProcess/InjectedBundle/DOM/InjectedBundleNodeHandle.h: Ditto.
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76267 268f45cc-cd09-0410-ab3c-d52691b4dbfc
    • commit-queue@webkit.org's avatar
      2011-01-20 Kimmo Kinnunen <kimmo.t.kinnunen@nokia.com> · ab8d0167
      commit-queue@webkit.org authored
              Reviewed by Andreas Kling.
              Remove null ptr deref that happens when reattaching to
              a new web process.
              Implement didRelaunchProcess that sets the drawing area size
              after the drawing area is re-instantiated.
              [Qt][WK2] Null ptr deref in UI process after web process has crashed
              * UIProcess/API/qt/qgraphicswkview.cpp:
              * UIProcess/API/qt/qwkpage.cpp:
              (QWKPagePrivate::didRelaunchProcess): Reset drawing area size after crash.
              * UIProcess/API/qt/qwkpage_p.h:
      git-svn-id: http://svn.webkit.org/repository/webkit/trunk@76262 268f45cc-cd09-0410-ab3c-d52691b4dbfc